ChemNet > CAS > 7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
7149-69-1 1,3-dichloro-2-methyl-5-nitrobenzene
termék neve |
1,3-dichloro-2-methyl-5-nitrobenzene |
Szinonimák |
2,6-Dichloro-4-nitrotoluene |
MF |
C7H5Cl2NO2 |
Molekulatömeg |
206.0261 |
InChI |
InChI=1/C7H5Cl2NO2/c1-4-6(8)2-5(10(11)12)3-7(4)9/h2-3H,1H3 |
CAS-szám |
7149-69-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.456g/cm3 |
Olvadáspont |
62℃ |
Forráspont |
279.6°C at 760 mmHg |
Törésmutató |
1.585 |
Gyulladáspont |
122.9°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|