ChemNet > CAS > 90567-39-8 3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione
90567-39-8 3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione
termék neve |
3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione |
Szinonimák |
3-(hydroxymethyl)-5-(methylsulfanyl)-1,3,4-thiadiazole-2(3H)-thione |
MF |
C4H6N2OS3 |
Molekulatömeg |
194.2982 |
InChI |
InChI=1/C4H6N2OS3/c1-9-3-5-6(2-7)4(8)10-3/h7H,2H2,1H3 |
CAS-szám |
90567-39-8 |
Molekuláris szerkezete |
|
Sűrűség |
1.64g/cm3 |
Olvadáspont |
72℃ |
Forráspont |
306.9°C at 760 mmHg |
Törésmutató |
1.771 |
Gyulladáspont |
139.4°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|