ChemNet > CAS > 136329-39-0 (R)-N-Methyl-1-phenyl-2-(1-pyrrolidino)ethylamine
136329-39-0 (R)-N-Methyl-1-phenyl-2-(1-pyrrolidino)ethylamine
Nama produk |
(R)-N-Methyl-1-phenyl-2-(1-pyrrolidino)ethylamine |
Sinonim |
(R)-(-)-N-Methyl-1-phenyl-2-(1-pyrrolidino)ethylamine; N-methyl-1-phenyl-2-pyrrolidin-1-ylethanamine |
MF |
C13H20N2 |
Berat Molekul |
204.3113 |
InChI |
InChI=1/C13H20N2/c1-14-13(11-15-9-5-6-10-15)12-7-3-2-4-8-12/h2-4,7-8,13-14H,5-6,9-11H2,1H3 |
CAS NO |
136329-39-0 |
Struktur Molekul |
|
Kepadatan |
1g/cm3 |
Titik didih |
296.1°C at 760 mmHg |
Indeks bias |
1.54 |
Titik nyala |
113.1°C |
Simbol bahaya |
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|