ChemNet > CAS > 157373-08-5 2,3,4-trifluorobenzoyl chloride
157373-08-5 2,3,4-trifluorobenzoyl chloride
Nama produk |
2,3,4-trifluorobenzoyl chloride |
MF |
C7H2ClF3O |
Berat Molekul |
194.5384 |
InChI |
InChI=1/C7H2ClF3O/c8-7(12)3-1-2-4(9)6(11)5(3)10/h1-2H |
CAS NO |
157373-08-5 |
Struktur Molekul |
|
Kepadatan |
1.514g/cm3 |
Titik didih |
203.2°C at 760 mmHg |
Indeks bias |
1.479 |
Titik nyala |
60.4°C |
Simbol bahaya |
C:Corrosive;
|
Kode Risiko |
R34:Causes burns.;
R36/37:Irritating to eyes and respiratory system.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|