17687-72-8 9-Oktil-9-heptadecanol
| Nama produk |
9-Oktil-9-heptadecanol |
| Sinonim |
; Tri-n-oktilmetanol; 9-oktilheptadecane-9-ol; 6-bromo-1H-indole-3-karbaldehida |
| Nama bahasa Inggris |
9-Octyl-9-heptadecanol; Tri-n-octylmethanol; 9-octylheptadecane-9-ol; 6-bromo-1H-indole-3-carbaldehyde |
| MF |
C9H6BrNO |
| Berat Molekul |
224.054 |
| InChI |
InChI=1/C9H6BrNO/c10-7-1-2-8-6(5-12)4-11-9(8)3-7/h1-5,11H |
| CAS NO |
17687-72-8 |
| EINECS |
241-673-2 |
| Struktur Molekul |
|
| Kepadatan |
1.727g/cm3 |
| Titik didih |
395.6°C at 760 mmHg |
| Indeks bias |
1.752 |
| Titik nyala |
193°C |
| Tekanan uap |
1.82E-06mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|