ChemNet > CAS > 245536-50-9 2,3-Difluoro-4-methylbenzaldehyde
245536-50-9 2,3-Difluoro-4-methylbenzaldehyde
Nama produk |
2,3-Difluoro-4-methylbenzaldehyde |
Nama bahasa Inggris |
2,3-Difluoro-4-methylbenzaldehyde; 2,3-Difluoro-p-tolualdehyde |
MF |
C8H6F2O |
Berat Molekul |
156.1294 |
InChI |
InChI=1/C8H6F2O/c1-5-2-3-6(4-11)8(10)7(5)9/h2-4H,1H3 |
CAS NO |
245536-50-9 |
Struktur Molekul |
|
Kepadatan |
1.241g/cm3 |
Titik didih |
204.2°C at 760 mmHg |
Indeks bias |
1.513 |
Titik nyala |
76.1°C |
Tekanan uap |
0.267mmHg at 25°C |
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|