ChemNet > CAS > 290313-19-8 4-sikloheksil-2-merkapto-6-okso-1,6-dihidropirimidin-5-karbonitril
290313-19-8 4-sikloheksil-2-merkapto-6-okso-1,6-dihidropirimidin-5-karbonitril
| Nama produk |
4-sikloheksil-2-merkapto-6-okso-1,6-dihidropirimidin-5-karbonitril |
| Sinonim |
6-sikloheksil-4-okso-2-tiokso-1,2,3,4-tetrahidropirimidin-5-karbonitril |
| Nama bahasa Inggris |
4-cyclohexyl-2-mercapto-6-oxo-1,6-dihydropyrimidine-5-carbonitrile;6-cyclohexyl-4-oxo-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile |
| MF |
C11H13N3OS |
| Berat Molekul |
235.3054 |
| InChI |
InChI=1/C11H13N3OS/c12-6-8-9(7-4-2-1-3-5-7)13-11(16)14-10(8)15/h7H,1-5H2,(H2,13,14,15,16) |
| CAS NO |
290313-19-8 |
| Struktur Molekul |
|
| Kepadatan |
1.32g/cm3 |
| Titik lebur |
300℃ |
| Indeks bias |
1.622 |
| Simbol bahaya |
Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S36/37:Wear suitable protective clothing and gloves.;
|
|