ChemNet > CAS > 38464-20-9 4-Chloro-3-nitrocoumarin
38464-20-9 4-Chloro-3-nitrocoumarin
Nama produk |
4-Chloro-3-nitrocoumarin |
Sinonim |
4-chloro-3-nitro-2H-chromen-2-one |
MF |
C9H4ClNO4 |
Berat Molekul |
225.5854 |
InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
CAS NO |
38464-20-9 |
Struktur Molekul |
|
Kepadatan |
1.6g/cm3 |
Titik lebur |
160-164℃ |
Titik didih |
338.7°C at 760 mmHg |
Indeks bias |
1.642 |
Titik nyala |
158.6°C |
Simbol bahaya |
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|