ChemNet > CAS > 4122-68-3 4-Chlorophenoxyacetyl chloride
4122-68-3 4-Chlorophenoxyacetyl chloride
Nama produk |
4-Chlorophenoxyacetyl chloride |
Sinonim |
(4-Chlorophenoxy)acetyl chloride; p-chlorophenoxyacetyl chloride |
MF |
C8H6Cl2O2 |
Berat Molekul |
205.038 |
InChI |
InChI=1/C8H6Cl2O2/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2 |
CAS NO |
4122-68-3 |
EINECS |
223-923-2 |
Struktur Molekul |
|
Kepadatan |
1.363g/cm3 |
Titik lebur |
18.8℃ |
Titik didih |
264.5°C at 760 mmHg |
Indeks bias |
1.542 |
Titik nyala |
112.9°C |
Simbol bahaya |
C:Corrosive;
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|