ChemNet > CAS > 423768-52-9 (1,5-dimethyl-1H-pyrazol-3-yl)methylamine
423768-52-9 (1,5-dimethyl-1H-pyrazol-3-yl)methylamine
Nama produk |
(1,5-dimethyl-1H-pyrazol-3-yl)methylamine |
Sinonim |
1-(1,5-dimethyl-1H-pyrazol-3-yl)methanamine; (1,5-dimethyl-1H-pyrazol-3-yl)methanamine |
MF |
C6H11N3 |
Berat Molekul |
125.1716 |
InChI |
InChI=1/C6H11N3/c1-5-3-6(4-7)8-9(5)2/h3H,4,7H2,1-2H3 |
CAS NO |
423768-52-9 |
Struktur Molekul |
|
Kepadatan |
1.12g/cm3 |
Titik didih |
229.3°C at 760 mmHg |
Indeks bias |
1.566 |
Titik nyala |
92.5°C |
Simbol bahaya |
C:Corrosive;
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|