| Nama produk |
4- (4-Chlorophenyl) -1,2,3,6-tetrahydropyridine hidroklorida |
| Sinonim |
; 4- (4-klorofenil) -1,2,3,6-tetrahidro-piridin HCl; 4- (4-Chloro Phenyl) 1,2,3-tetra hidropiridin HCL; 4- (4-klorofenil) -1,2,3,6-tetrahidropiridinium |
| Nama bahasa Inggris |
4-(4-Chlorophenyl)-1,2,3,6-tetrahydropyridine hydrochloride; 4-(4-Chlorophenyl)-1,2,3,6-tetrahydro-pyridine HCl; 4-(4-Chloro Phenyl)1,2,3-Tetra Hydropyridine HCL; 4-(4-chlorophenyl)-1,2,3,6-tetrahydropyridinium |
| MF |
C11H13ClN |
| Berat Molekul |
194.6801 |
| InChI |
InChI=1/C11H12ClN/c12-11-3-1-9(2-4-11)10-5-7-13-8-6-10/h1-5,13H,6-8H2/p+1 |
| CAS NO |
51304-61-1 |
| EINECS |
257-126-6 |
| Struktur Molekul |
|
| Titik lebur |
199-204℃ |
| Titik didih |
296.5°C at 760 mmHg |
| Titik nyala |
133.1°C |
| Tekanan uap |
0.00143mmHg at 25°C |
| Simbol bahaya |
T:Toxic;
|
| Kode Risiko |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Keselamatan Deskripsi |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|