ChemNet > CAS > 51628-12-7 4-Iodophenylacetonitrile
51628-12-7 4-Iodophenylacetonitrile
Nama produk |
4-Iodophenylacetonitrile |
Sinonim |
4-Iodobenzyl cyanide |
MF |
C8H6IN |
Berat Molekul |
243.0444 |
InChI |
InChI=1/C8H6IN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5H2 |
CAS NO |
51628-12-7 |
Struktur Molekul |
|
Kepadatan |
1.764g/cm3 |
Titik didih |
285.8°C at 760 mmHg |
Indeks bias |
1.624 |
Titik nyala |
126.6°C |
Simbol bahaya |
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Deskripsi |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|