ChemNet > CAS > 556-48-9 1,4-Cyclohexanediol, mixture of cis and trans
556-48-9 1,4-Cyclohexanediol, mixture of cis and trans
| Nama produk |
1,4-Cyclohexanediol, mixture of cis and trans |
| Nama bahasa Inggris |
1,4-Cyclohexanediol, mixture of cis and trans; Cyclohexanediolcistrans; 1,4-Cyclohexanediol; Hexahydrohydroquinone; 1,4-Hexandiol; Quinitol; 1,4-Bis(hydroxymethyl)-cyclohexane; cyclohexane-1,4-diol; trans-cyclohexane-1,4-diol; 1,4-Cyclohexanediol (cis & trans mixture) |
| MF |
C6H12O2 |
| Berat Molekul |
116.1583 |
| InChI |
InChI=1/C6H12O2/c7-5-1-2-6(8)4-3-5/h5-8H,1-4H2/t5-,6- |
| CAS NO |
556-48-9 |
| EINECS |
209-126-2 |
| Struktur Molekul |
|
| Kepadatan |
1.156g/cm3 |
| Titik lebur |
98-100℃ |
| Titik didih |
252.4°C at 760 mmHg |
| Indeks bias |
1.526 |
| Titik nyala |
65.6°C |
| Tekanan uap |
0.00301mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:;
|
|