| Nama produk |
Asam D-glukonat, siklik 4,5-ester dengan asam borat, garam kalsium (2: 1) |
| Sinonim |
Kalsium borogluconate; AI3-52160; Asam D-glukonat, siklik 4,5-ester dengan asam borat, garam kalsium (2:1); kalsium bis{2,3-dihidroksi-3-[2-hidroksi-5-(hidroksimetil)-1,3,2-dioxaborolan-4-yl]propanoate}; 2,3-dihidroksi-3- [2-hidroksi-5- (hidroksimetil) -1,3,2-dioxaborolan-4-yl] asam propanoat |
| Nama bahasa Inggris |
D-gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1);Calcium borogluconate; AI3-52160; D-Gluconic acid, cyclic 4,5-ester with boric acid, calcium salt (2:1); calcium bis{2,3-dihydroxy-3-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]propanoate}; 2,3-dihydroxy-3-[2-hydroxy-5-(hydroxymethyl)-1,3,2-dioxaborolan-4-yl]propanoic acid |
| MF |
C6H11BO8 |
| Berat Molekul |
221.9577 |
| InChI |
InChI=1/C6H11BO8/c8-1-2-5(15-7(13)14-2)3(9)4(10)6(11)12/h2-5,8-10,13H,1H2,(H,11,12) |
| CAS NO |
5743-34-0 |
| EINECS |
227-264-1 |
| Struktur Molekul |
|
| Kepadatan |
1.68g/cm3 |
| Titik didih |
530.9°C at 760 mmHg |
| Indeks bias |
1.558 |
| Titik nyala |
274.9°C |
| Tekanan uap |
1.73E-13mmHg at 25°C |
|