ChemNet > CAS > 67386-38-3 2-phenoxyethanimidamide hidroklorida
67386-38-3 2-phenoxyethanimidamide hidroklorida
| Nama produk |
2-phenoxyethanimidamide hidroklorida |
| Sinonim |
(1Z)-2-phenoxyethanimidamide; (1Z)-2-phenoxyethanimidamide hidroklorida |
| Nama bahasa Inggris |
2-phenoxyethanimidamide hydrochloride;(1Z)-2-phenoxyethanimidamide; (1Z)-2-phenoxyethanimidamide hydrochloride |
| MF |
C8H11ClN2O |
| Berat Molekul |
186.6387 |
| InChI |
InChI=1/C8H10N2O.ClH/c9-8(10)6-11-7-4-2-1-3-5-7;/h1-5H,6H2,(H3,9,10);1H |
| CAS NO |
67386-38-3 |
| Struktur Molekul |
|
| Titik didih |
269.3°C at 760 mmHg |
| Titik nyala |
116.7°C |
| Tekanan uap |
0.00732mmHg at 25°C |
| Simbol bahaya |
Xn:Harmful;
|
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|