ChemNet > CAS > 1129-35-7 methyl 4-cyanobenzoate
1129-35-7 methyl 4-cyanobenzoate
| שם המוצר |
methyl 4-cyanobenzoate |
| נרדפות |
4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
| מולקולרית פורמולה |
C9H7NO2 |
| משקל מולקולרי |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
| מספר CAS |
1129-35-7 |
| EINECS |
214-443-4 |
| מבנה מולקולרי |
|
| צפיפות |
1.18g/cm3 |
| נקודת ההתוך |
62℃ |
| נקודת רתיחה |
274.9°C at 760 mmHg |
| משקל סגולי |
1.535 |
| נקודת הבזק |
131.2°C |
| Hazard סימנים |
|
| סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| בטיחות תיאור |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
