ChemNet > CAS > 1141-23-7 3-(4-Chlorophenyl)glutaramic acid
1141-23-7 3-(4-Chlorophenyl)glutaramic acid
שם המוצר |
3-(4-Chlorophenyl)glutaramic acid |
נרדפות |
3-(4-Chloro phenyl) Glutaric acid monoamide; 5-amino-3-(4-chlorophenyl)-5-oxopentanoic acid; β-(4-chlorophenyl)Glutarimide |
מולקולרית פורמולה |
C11H12ClNO3 |
משקל מולקולרי |
241.6709 |
InChI |
InChI=1/C11H12ClNO3/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H2,13,14)(H,15,16) |
מספר CAS |
1141-23-7 |
מבנה מולקולרי |
|
צפיפות |
1.343g/cm3 |
נקודת רתיחה |
494.9°C at 760 mmHg |
משקל סגולי |
1.578 |
נקודת הבזק |
253.1°C |
Hazard סימנים |
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|