ChemNet > CAS > 1552-94-9 (2E,4E)-5-phenylpenta-2,4-dienoic acid
1552-94-9 (2E,4E)-5-phenylpenta-2,4-dienoic acid
שם המוצר |
(2E,4E)-5-phenylpenta-2,4-dienoic acid |
שם אנגלי |
(2E,4E)-5-phenylpenta-2,4-dienoic acid; Cinnamalacetic acid; 5-phenylpenta-2,4-dienoic acid |
מולקולרית פורמולה |
C11H10O2 |
משקל מולקולרי |
174.1959 |
InChI |
InChI=1/C11H10O2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-9H,(H,12,13)/b8-4+,9-5+ |
מספר CAS |
1552-94-9 |
EINECS |
216-298-2 |
מבנה מולקולרי |
|
צפיפות |
1.148g/cm3 |
נקודת רתיחה |
356.1°C at 760 mmHg |
משקל סגולי |
1.616 |
נקודת הבזק |
257.6°C |
לחץ אדים |
1.09E-05mmHg at 25°C |
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|