ChemNet > CAS > 191-07-1 Coronene
191-07-1 Coronene
שם המוצר |
Coronene |
נרדפות |
Hexabenzobenzene; Coronene (purity) |
מולקולרית פורמולה |
C24H12 |
משקל מולקולרי |
300.3521 |
InChI |
InChI=1/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
מספר CAS |
191-07-1 |
EINECS |
205-881-7 |
מבנה מולקולרי |
|
צפיפות |
1.467g/cm3 |
נקודת ההתוך |
438-440℃ |
נקודת רתיחה |
525.6°C at 760 mmHg |
משקל סגולי |
2.139 |
נקודת הבזק |
265.2°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|