ChemNet > CAS > 3129-92-8 benzoic acid, compound with cyclohexylamine (1:1)
3129-92-8 benzoic acid, compound with cyclohexylamine (1:1)
| שם המוצר |
benzoic acid, compound with cyclohexylamine (1:1) |
| נרדפות |
Benzoic acid, compd. with cyclohexanamine (1:1); Benzoic acid, compd. with cyclohexylamine (1:1); Cyclohexylamine benzoate; Cyclohexylammonium benzoate; N-Cyclohexylammonium benzoate; NSC 211025; Benzoic acid, compd. with cyclohexylamine (1:1) (8CI); Benzoic acid, compound with cyclohexylamine (1:1); cyclohexanamine benzoate (1:1) |
| מולקולרית פורמולה |
C13H19NO2 |
| משקל מולקולרי |
221.2955 |
| InChI |
InChI=1/C7H6O2.C6H13N/c8-7(9)6-4-2-1-3-5-6;7-6-4-2-1-3-5-6/h1-5H,(H,8,9);6H,1-5,7H2 |
| מספר CAS |
3129-92-8 |
| EINECS |
221-516-4 |
| מבנה מולקולרי |
|
| נקודת רתיחה |
249.3°C at 760 mmHg |
| נקודת הבזק |
111.4°C |
| Hazard סימנים |
|
| סיכונים קודי |
|
| בטיחות תיאור |
|
|
