359-37-5 iodotrifluoroethylene
שם המוצר |
iodotrifluoroethylene |
שם אנגלי |
iodotrifluoroethylene; Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
מולקולרית פורמולה |
C2F3I |
משקל מולקולרי |
207.9211 |
InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
מספר CAS |
359-37-5 |
EINECS |
206-629-9 |
מבנה מולקולרי |
|
צפיפות |
2.311g/cm3 |
נקודת רתיחה |
30°C at 760 mmHg |
משקל סגולי |
1.457 |
לחץ אדים |
636mmHg at 25°C |
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|