ChemNet > CAS > 36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
36263-51-1 1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile
שם המוצר |
1-(4-Methoxyphenyl)-1-cyclohexanecarbonitrile |
נרדפות |
1-(4-Methoxyphenyl)cyclohexanecarbonitrile |
מולקולרית פורמולה |
C14H17NO |
משקל מולקולרי |
215.2909 |
InChI |
InChI=1/C14H17NO/c1-16-13-7-5-12(6-8-13)14(11-15)9-3-2-4-10-14/h5-8H,2-4,9-10H2,1H3 |
מספר CAS |
36263-51-1 |
EINECS |
252-938-7 |
מבנה מולקולרי |
|
צפיפות |
1.06g/cm3 |
נקודת ההתוך |
40-45℃ |
נקודת רתיחה |
362°C at 760 mmHg |
משקל סגולי |
1.538 |
נקודת הבזק |
152.6°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S24/25:Avoid contact with skin and eyes.;
|
|