ChemNet > CAS > 38464-20-9 4-Chloro-3-nitrocoumarin
38464-20-9 4-Chloro-3-nitrocoumarin
| שם המוצר |
4-Chloro-3-nitrocoumarin |
| נרדפות |
4-chloro-3-nitro-2H-chromen-2-one |
| מולקולרית פורמולה |
C9H4ClNO4 |
| משקל מולקולרי |
225.5854 |
| InChI |
InChI=1/C9H4ClNO4/c10-7-5-3-1-2-4-6(5)15-9(12)8(7)11(13)14/h1-4H |
| מספר CAS |
38464-20-9 |
| מבנה מולקולרי |
|
| צפיפות |
1.6g/cm3 |
| נקודת ההתוך |
160-164℃ |
| נקודת רתיחה |
338.7°C at 760 mmHg |
| משקל סגולי |
1.642 |
| נקודת הבזק |
158.6°C |
| Hazard סימנים |
|
| סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
