ChemNet > CAS > 3857-25-8 5-Methyl-2-furanmethanol
3857-25-8 5-Methyl-2-furanmethanol
שם המוצר |
5-Methyl-2-furanmethanol |
נרדפות |
(5-Methyl-2-furyl)methanol; (5-methylfuran-2-yl)methanol |
מולקולרית פורמולה |
C6H8O2 |
משקל מולקולרי |
112.1265 |
InChI |
InChI=1/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 |
מספר CAS |
3857-25-8 |
מבנה מולקולרי |
|
צפיפות |
1.095g/cm3 |
נקודת רתיחה |
178.5°C at 760 mmHg |
משקל סגולי |
1.494 |
נקודת הבזק |
61.8°C |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|