51605-97-1 4-Amino-2-bromocumene
שם המוצר |
4-Amino-2-bromocumene |
שם אנגלי |
4-Amino-2-bromocumene; 2-Bromo-4-isopropylaniline; 2-bromo-4-(propan-2-yl)aniline |
מולקולרית פורמולה |
C9H12BrN |
משקל מולקולרי |
214.1023 |
InChI |
InChI=1/C9H12BrN/c1-6(2)7-3-4-9(11)8(10)5-7/h3-6H,11H2,1-2H3 |
מספר CAS |
51605-97-1 |
מבנה מולקולרי |
|
צפיפות |
1.355g/cm3 |
נקודת רתיחה |
271.8°C at 760 mmHg |
משקל סגולי |
1.577 |
נקודת הבזק |
118.2°C |
לחץ אדים |
0.00631mmHg at 25°C |
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|