| שם המוצר |
תיאופילין--2-אמינואתנול |
| נרדפות |
תיאופילין אולמין; אתנולמין תיאופילין; קליסמאתאן; אתנול, 2-אמינו-, compd.עם תיאופילין (1:1); צי-תאופילין; מונותאמין; מונותאמין; מונוקסנטיל; תיאמין; תרכובת תיאופילין עם 2-אמינואתנול (1: 1); תיאופילין מונואתנולמין; תיאופילין מונואתנולמין; אונופילין; 1H-Purine-2,6-dione, 3,7-dihydro-1,3-dimethyl-, compd.עם 2-אמינואתנול (1: 1); תיאופילין 2-אמינואתנול; תיאופילין, compd.with 2-aminoethanol (1: 1); 1,3-דימתיל-3,7-דיהידרו-1H-פורין-2,6-דיון - 2-אמינואתנול (1:1) |
| שם אנגלי |
theophylline--2-aminoethanol;Theophylline olamine; Theophylline ethanolamine; Clysmathane; Ethanol, 2-amino-, compd. with theophylline (1:1); Fleet-theophylline; Monotheamin; Monotheamine; Monoxantil; Theamin; Theophylline compound with 2-aminoethanol (1:1); Theophylline monoethanolamine; Theopylline monoethanolamine; Unophyllin; 1H-Purine-2,6-dione, 3,7-dihydro-1,3-dimethyl-, compd. with 2-aminoethanol (1:1); Theophylline 2-aminoethanol; Theophylline, compd. with 2-aminoethanol (1:1); 1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione - 2-aminoethanol (1:1) |
| מולקולרית פורמולה |
C9H15N5O3 |
| משקל מולקולרי |
241.2471 |
| InChI |
InChI=1/C7H8N4O2.C2H7NO/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h3H,1-2H3,(H,8,9);4H,1-3H2 |
| מספר CAS |
573-41-1 |
| EINECS |
209-355-8 |
| מבנה מולקולרי |
|
| נקודת רתיחה |
454.1°C at 760 mmHg |
| נקודת הבזק |
228.4°C |
| לחץ אדים |
1.96E-08mmHg at 25°C |
|