101-99-5 N-Phenylurethane
उत्पाद का नाम |
N-Phenylurethane |
अंग्रेजी नाम |
N-Phenylurethane; Ethyl carbanilate~Ethyl N-phenylcarbamate; ethyl phenylcarbamate |
आणविक फार्मूला |
C9H11NO2 |
आण्विक वजन |
165.1891 |
InChI |
InChI=1/C9H11NO2/c1-2-12-9(11)10-8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,10,11) |
कैस रजिस्टी संख्या |
101-99-5 |
EINECS |
202-995-9 |
आणविक संरचना |
|
घनत्व |
1.136g/cm3 |
उबलने का समय |
238°C at 760 mmHg |
अपवर्तक सूचकांक |
1.558 |
फ्लैश प्वाइंट |
79.2°C |
वाष्प का दबाव |
0.0434mmHg at 25°C |
खतरे के कोड |
R40:Possible risks of irreversible effects.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|