107-84-6 1-Chloro-3-methylbutane
उत्पाद का नाम |
1-Chloro-3-methylbutane |
अंग्रेजी नाम |
1-Chloro-3-methylbutane; Isoamyl chloride~Isopentyl chloride |
आणविक फार्मूला |
C5H11Cl |
आण्विक वजन |
106.5938 |
InChI |
InChI=1/C5H11Cl/c1-5(2)3-4-6/h5H,3-4H2,1-2H3 |
कैस रजिस्टी संख्या |
107-84-6 |
EINECS |
203-525-5 |
आणविक संरचना |
|
घनत्व |
0.867g/cm3 |
उबलने का समय |
98.3°C at 760 mmHg |
अपवर्तक सूचकांक |
1.403 |
फ्लैश प्वाइंट |
9.8°C |
वाष्प का दबाव |
46.2mmHg at 25°C |
खतरे के कोड |
R11:Highly flammable.;
|
सुरक्षा विवरण |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|