ChemNet > CAS > 1129-35-7 methyl 4-cyanobenzoate
1129-35-7 methyl 4-cyanobenzoate
| उत्पाद का नाम |
methyl 4-cyanobenzoate |
| समानार्थी |
4-Cyanobenzoic acid methyl ester; Cyanbenzoicacidmethylester; 4-Cy!nobenzoic acid methyl ester |
| आणविक फार्मूला |
C9H7NO2 |
| आण्विक वजन |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-12-9(11)8-4-2-7(6-10)3-5-8/h2-5H,1H3 |
| कैस रजिस्टी संख्या |
1129-35-7 |
| EINECS |
214-443-4 |
| आणविक संरचना |
|
| घनत्व |
1.18g/cm3 |
| गलनांक |
62℃ |
| उबलने का समय |
274.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.535 |
| फ्लैश प्वाइंट |
131.2°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
