ChemNet > CAS > 120-61-6 Dimethyl terephthalate
120-61-6 Dimethyl terephthalate
उत्पाद का नाम |
Dimethyl terephthalate |
समानार्थी |
D.M.T.; Terephthalic acid dimethyl ester; Benzene-1,4-dicarboxylic acid dimethyl ester; Terephthalic acid dimethyl ester; dimethyl cyclohexane-1,4-dicarboxylate; 1,3-benzodioxol-5-yl methylcarbamate; dimethyl benzene-1,4-dicarboxylate; 4-(methoxycarbonyl)benzoic acid; dimethyl benzene-1,2-dicarboxylate; DMT |
आणविक फार्मूला |
C10H10O4 |
आण्विक वजन |
194.184 |
InChI |
InChI=1/C10H10O4/c1-13-9(11)7-5-3-4-6-8(7)10(12)14-2/h3-6H,1-2H3 |
कैस रजिस्टी संख्या |
120-61-6 |
EINECS |
204-411-8 |
आणविक संरचना |
|
घनत्व |
1.175g/cm3 |
गलनांक |
140-143℃ |
उबलने का समय |
282.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.514 |
फ्लैश प्वाइंट |
146.7°C |
खतरा प्रतीक |
|
खतरे के कोड |
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|