ChemNet > CAS > 13191-36-1 2,5-Dibromo-3-methylthiophene
13191-36-1 2,5-Dibromo-3-methylthiophene
उत्पाद का नाम |
2,5-Dibromo-3-methylthiophene |
अंग्रेजी नाम |
2,5-Dibromo-3-methylthiophene; |
आणविक फार्मूला |
C5H4Br2S |
आण्विक वजन |
255.9583 |
InChI |
InChI=1/C5H4Br2S/c1-3-2-4(6)8-5(3)7/h2H,1H3 |
कैस रजिस्टी संख्या |
13191-36-1 |
EINECS |
236-147-4 |
आणविक संरचना |
|
घनत्व |
2.006g/cm3 |
उबलने का समय |
230.2°C at 760 mmHg |
अपवर्तक सूचकांक |
1.62 |
फ्लैश प्वाइंट |
93°C |
वाष्प का दबाव |
0.101mmHg at 25°C |
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|