ChemNet > CAS > 145129-54-0 Methyl 2,5-dichlorothiophene-3-carboxylate
145129-54-0 Methyl 2,5-dichlorothiophene-3-carboxylate
| उत्पाद का नाम |
Methyl 2,5-dichlorothiophene-3-carboxylate |
| समानार्थी |
2,5-Dichlorothiophene-3-carboxylic acid methyl ester |
| आणविक फार्मूला |
C6H4Cl2O2S |
| आण्विक वजन |
211.0658 |
| InChI |
InChI=1/C6H4Cl2O2S/c1-10-6(9)3-2-4(7)11-5(3)8/h2H,1H3 |
| कैस रजिस्टी संख्या |
145129-54-0 |
| आणविक संरचना |
|
| घनत्व |
1.5g/cm3 |
| उबलने का समय |
257.3°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.57 |
| फ्लैश प्वाइंट |
109.4°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
