14979-39-6 4-Methyl-3-heptanol
उत्पाद का नाम |
4-Methyl-3-heptanol |
अंग्रेजी नाम |
4-Methyl-3-heptanol; 4-Methyl-3-heptanol,mixture of isomers; Ethyl 2-pentyl carbinol; 4-methylheptan-3-ol; (3R,4S)-4-methylheptan-3-ol; (3S,4S)-4-methylheptan-3-ol; (3R,4R)-4-methylheptan-3-ol; (3S,4R)-4-methylheptan-3-ol |
आणविक फार्मूला |
C8H18O |
आण्विक वजन |
130.2279 |
InChI |
InChI=1/C8H18O/c1-4-6-7(3)8(9)5-2/h7-9H,4-6H2,1-3H3/t7-,8+/m1/s1 |
कैस रजिस्टी संख्या |
14979-39-6 |
EINECS |
239-058-9 |
आणविक संरचना |
|
घनत्व |
0.819g/cm3 |
उबलने का समय |
158.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.424 |
फ्लैश प्वाइंट |
54.4°C |
वाष्प का दबाव |
0.927mmHg at 25°C |
खतरे के कोड |
R10:Flammable.;
|
सुरक्षा विवरण |
S16:Keep away from sources of ignition - No smoking.;
|
|