1530-04-7 1,1-Diphenylhexane
उत्पाद का नाम |
1,1-Diphenylhexane |
अंग्रेजी नाम |
1,1-Diphenylhexane;1,1'-hexane-1,1-diyldibenzene |
आणविक फार्मूला |
C18H22 |
आण्विक वजन |
238.3673 |
InChI |
InChI=1/C18H22/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17/h4-5,7-14,18H,2-3,6,15H2,1H3 |
कैस रजिस्टी संख्या |
1530-04-7 |
आणविक संरचना |
|
घनत्व |
0.945g/cm3 |
उबलने का समय |
331.4°C at 760 mmHg |
अपवर्तक सूचकांक |
1.536 |
फ्लैश प्वाइंट |
162.4°C |
वाष्प का दबाव |
0.000301mmHg at 25°C |
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|