ChemNet > CAS > 1552-94-9 (2E,4E)-5-phenylpenta-2,4-dienoic acid
1552-94-9 (2E,4E)-5-phenylpenta-2,4-dienoic acid
उत्पाद का नाम |
(2E,4E)-5-phenylpenta-2,4-dienoic acid |
अंग्रेजी नाम |
(2E,4E)-5-phenylpenta-2,4-dienoic acid; Cinnamalacetic acid; 5-phenylpenta-2,4-dienoic acid |
आणविक फार्मूला |
C11H10O2 |
आण्विक वजन |
174.1959 |
InChI |
InChI=1/C11H10O2/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-9H,(H,12,13)/b8-4+,9-5+ |
कैस रजिस्टी संख्या |
1552-94-9 |
EINECS |
216-298-2 |
आणविक संरचना |
|
घनत्व |
1.148g/cm3 |
उबलने का समय |
356.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.616 |
फ्लैश प्वाइंट |
257.6°C |
वाष्प का दबाव |
1.09E-05mmHg at 25°C |
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|