1732-08-7 Dimethyl pimelate
उत्पाद का नाम |
Dimethyl pimelate |
अंग्रेजी नाम |
Dimethyl pimelate; Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
आणविक फार्मूला |
C9H16O4 |
आण्विक वजन |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
कैस रजिस्टी संख्या |
1732-08-7 |
EINECS |
217-057-4 |
आणविक संरचना |
|
घनत्व |
1.022g/cm3 |
उबलने का समय |
250.3°C at 760 mmHg |
अपवर्तक सूचकांक |
1.427 |
फ्लैश प्वाइंट |
105.4°C |
वाष्प का दबाव |
0.0219mmHg at 25°C |
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|