ChemNet > CAS > 1732-08-7 Dimethyl pimelate
1732-08-7 Dimethyl pimelate
| उत्पाद का नाम |
Dimethyl pimelate |
| समानार्थी |
Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
| आणविक फार्मूला |
C9H16O4 |
| आण्विक वजन |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
| कैस रजिस्टी संख्या |
1732-08-7 |
| EINECS |
217-057-4 |
| आणविक संरचना |
|
| घनत्व |
1.022g/cm3 |
| उबलने का समय |
250.3°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.427 |
| फ्लैश प्वाइंट |
105.4°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
