CAS No: 2049-55-0, Chemical Name: Borane-triphenylphosphine complex
Chemical CAS Database with Global Chemical Suppliers - ChemNet
the physical and chemical property of 2049-55-0, Borane-triphenylphosphine complex is provided by ChemNet.com

  ChemNet > CAS > 2049-55-0 Borane-triphenylphosphine complex

2049-55-0 Borane-triphenylphosphine complex

उत्पाद का नाम Borane-triphenylphosphine complex
समानार्थी Borane-triphenylphosphine (1:1); borane, compd. with triphenylphosphine (1:1); borane-triphenylphosphane (1:1); Borane-Trimethylamine; Triphenylphosphine borane; Borane-Triphenylphosphine; Borane triphenylphosphine complex
आणविक फार्मूला C18H18BP
आण्विक वजन 276.1203
InChI InChI=1/C18H15P.BH3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H3
कैस रजिस्टी संख्या 2049-55-0
आणविक संरचना 2049-55-0 Borane-triphenylphosphine complex
उबलने का समय 360°C at 760 mmHg
फ्लैश प्वाइंट 181.7°C
खतरा प्रतीक
खतरे के कोड
सुरक्षा विवरण