ChemNet > CAS > 20850-43-5 5-(chloromethyl)-1,3-benzodioxole
20850-43-5 5-(chloromethyl)-1,3-benzodioxole
उत्पाद का नाम |
5-(chloromethyl)-1,3-benzodioxole |
समानार्थी |
3,4-Methylenedioxybenzyl chloride; 5-chloro-1,3-benzodioxole; Piperonal chloride |
आणविक फार्मूला |
C7H5ClO2 |
आण्विक वजन |
156.5664 |
InChI |
InChI=1/C7H5ClO2/c8-5-1-2-6-7(3-5)10-4-9-6/h1-3H,4H2 |
कैस रजिस्टी संख्या |
20850-43-5 |
EINECS |
244-081-2 |
आणविक संरचना |
|
घनत्व |
1.39g/cm3 |
उबलने का समय |
186°C at 760 mmHg |
अपवर्तक सूचकांक |
1.577 |
फ्लैश प्वाइंट |
93.9°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|