2155-60-4 dibutyl itaconate
उत्पाद का नाम |
dibutyl itaconate |
अंग्रेजी नाम |
dibutyl itaconate; Itaconic acid di-n-butyl ester; dibutyl 2-methylidenebutanedioate |
आणविक फार्मूला |
C13H22O4 |
आण्विक वजन |
242.3114 |
InChI |
InChI=1/C13H22O4/c1-4-6-8-16-12(14)10-11(3)13(15)17-9-7-5-2/h3-10H2,1-2H3 |
कैस रजिस्टी संख्या |
2155-60-4 |
EINECS |
218-451-9 |
आणविक संरचना |
|
घनत्व |
0.989g/cm3 |
उबलने का समय |
307.4°C at 760 mmHg |
अपवर्तक सूचकांक |
1.446 |
फ्लैश प्वाइंट |
142.2°C |
वाष्प का दबाव |
0.000728mmHg at 25°C |
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|