ChemNet > CAS > 261762-46-3 3-Chloro-2,6-difluorobenzylamine
261762-46-3 3-Chloro-2,6-difluorobenzylamine
उत्पाद का नाम |
3-Chloro-2,6-difluorobenzylamine |
समानार्थी |
1-(3-chloro-2,6-difluorophenyl)methanamine |
आणविक फार्मूला |
C7H6ClF2N |
आण्विक वजन |
177.579 |
InChI |
InChI=1/C7H6ClF2N/c8-5-1-2-6(9)4(3-11)7(5)10/h1-2H,3,11H2 |
कैस रजिस्टी संख्या |
261762-46-3 |
आणविक संरचना |
|
घनत्व |
1.368g/cm3 |
उबलने का समय |
212°C at 760 mmHg |
अपवर्तक सूचकांक |
1.522 |
फ्लैश प्वाइंट |
82°C |
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|