ChemNet > CAS > 28098-03-5 octanoic acid, compound with 2-aminoethanol (1:1)
28098-03-5 octanoic acid, compound with 2-aminoethanol (1:1)
| उत्पाद का नाम |
octanoic acid, compound with 2-aminoethanol (1:1) |
| समानार्थी |
Octanoic acid, compd. with 2-aminoethanol (1:1); Caprylic acid, monoethanolamine salt; Monoethanolamine caprylate; Monoethanolamine octanoate; Octanoic acid, compound with 2-aminoethanol (1:1); octanoic acid - 2-aminoethanol (1:1) |
| आणविक फार्मूला |
C10H23NO3 |
| आण्विक वजन |
205.2945 |
| InChI |
InChI=1/C8H16O2.C2H7NO/c1-2-3-4-5-6-7-8(9)10;3-1-2-4/h2-7H2,1H3,(H,9,10);4H,1-3H2 |
| कैस रजिस्टी संख्या |
28098-03-5 |
| EINECS |
248-838-8 |
| आणविक संरचना |
|
| उबलने का समय |
239.3°C at 760 mmHg |
| फ्लैश प्वाइंट |
107.4°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
|
| सुरक्षा विवरण |
|
|
