ChemNet > CAS > 301699-39-8 (3,5-Dimethyl-4-methoxyphenyl)boronic acid
301699-39-8 (3,5-Dimethyl-4-methoxyphenyl)boronic acid
उत्पाद का नाम |
(3,5-Dimethyl-4-methoxyphenyl)boronic acid |
अंग्रेजी नाम |
(3,5-Dimethyl-4-methoxyphenyl)boronic acid; 4-Methoxy-3,5-dimethylbenzeneboronic acid; 3,5-Dimethyl-4-methoxybenzeneboronic acid~4-Methoxy-3,5-dimethylphenylboronic acid; (4-methoxy-3,5-dimethylphenyl)boronic acid |
आणविक फार्मूला |
C9H13BO3 |
आण्विक वजन |
180.0087 |
InChI |
InChI=1/C9H13BO3/c1-6-4-8(10(11)12)5-7(2)9(6)13-3/h4-5,11-12H,1-3H3 |
कैस रजिस्टी संख्या |
301699-39-8 |
आणविक संरचना |
|
घनत्व |
1.11g/cm3 |
गलनांक |
235-242℃ |
उबलने का समय |
335.8°C at 760 mmHg |
अपवर्तक सूचकांक |
1.517 |
फ्लैश प्वाइंट |
156.9°C |
वाष्प का दबाव |
4.6E-05mmHg at 25°C |
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|