ChemNet > CAS > 344-14-9 dimethyl fluoromalonate
344-14-9 dimethyl fluoromalonate
| उत्पाद का नाम |
dimethyl fluoromalonate |
| समानार्थी |
Fluoromalonic acid dimethyl ester; dimethyl fluoropropanedioate; 2-Fluoro-malonic acid dimethyl ester |
| आणविक फार्मूला |
C5H7FO4 |
| आण्विक वजन |
150.1051 |
| InChI |
InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| कैस रजिस्टी संख्या |
344-14-9 |
| आणविक संरचना |
|
| घनत्व |
1.211g/cm3 |
| उबलने का समय |
140.3°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.382 |
| फ्लैश प्वाइंट |
38.4°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R34:Causes burns.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
