ChemNet > CAS > 34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
34590-94-8 dipropylene glycol monomethyl ether, mixture of isomers
उत्पाद का नाम |
dipropylene glycol monomethyl ether, mixture of isomers |
अंग्रेजी नाम |
dipropylene glycol monomethyl ether, mixture of isomers; Di(propylene glycol) methyl ether; Methoxypropoxypropanol; Dipropylene glycol monomethyl ether; DPM |
आणविक फार्मूला |
C7H16O3 |
आण्विक वजन |
148.2001 |
InChI |
InChI=1/C7H16O3/c1-3-7(8)10-6-4-5-9-2/h7-8H,3-6H2,1-2H3 |
कैस रजिस्टी संख्या |
34590-94-8 |
EINECS |
252-104-2 |
आणविक संरचना |
|
घनत्व |
0.958g/cm3 |
उबलने का समय |
155.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.423 |
फ्लैश प्वाइंट |
47.9°C |
वाष्प का दबाव |
1.09mmHg at 25°C |
सुरक्षा विवरण |
S23:;
S24/25:;
|
|