359-37-5 iodotrifluoroethylene
उत्पाद का नाम |
iodotrifluoroethylene |
अंग्रेजी नाम |
iodotrifluoroethylene; Trifluoroiodoethylene; 1,1,2-trifluoro-2-iodoethene |
आणविक फार्मूला |
C2F3I |
आण्विक वजन |
207.9211 |
InChI |
InChI=1/C2F3I/c3-1(4)2(5)6 |
कैस रजिस्टी संख्या |
359-37-5 |
EINECS |
206-629-9 |
आणविक संरचना |
|
घनत्व |
2.311g/cm3 |
उबलने का समय |
30°C at 760 mmHg |
अपवर्तक सूचकांक |
1.457 |
वाष्प का दबाव |
636mmHg at 25°C |
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|