ChemNet > CAS > 4511-42-6 L-Lactide S
4511-42-6 L-Lactide S
| उत्पाद का नाम |
L-Lactide S |
| समानार्थी |
(3S)-cis-3,6-Dimethyl-1,4-dioxane-2,5-dione; Lactide; L-Lactide; (3S)-Cis-3,6-dimethyl-1,4-dioxane-2,5-dione; (S,S)-3,6-Dimethyl-1,4-dioxane-2,5-dione; L-Lactide; 3,6-dimethyl-1,4-dioxane-2,5-dione; (3R,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione; L-(-)-Lactide |
| आणविक फार्मूला |
C6H8O4 |
| आण्विक वजन |
144.1253 |
| InChI |
InChI=1/C6H8O4/c1-3-5(7)10-4(2)6(8)9-3/h3-4H,1-2H3/t3-,4+ |
| कैस रजिस्टी संख्या |
4511-42-6 |
| EINECS |
224-832-0 |
| आणविक संरचना |
|
| घनत्व |
1.186g/cm3 |
| गलनांक |
92-98℃ |
| उबलने का समय |
285.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.429 |
| फ्लैश प्वाइंट |
150.6°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37:Irritating to eyes and respiratory system.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
