ChemNet > CAS > 4771-49-7 6-Methylindole-3-caboxaldehyde
4771-49-7 6-Methylindole-3-caboxaldehyde
उत्पाद का नाम |
6-Methylindole-3-caboxaldehyde |
समानार्थी |
6-Methylindole-3-carboxaldehyde; 3-Formyl-6-methylindole; 6-methyl-1H-indole-3-carbaldehyde |
आणविक फार्मूला |
C10H9NO |
आण्विक वजन |
159.1846 |
InChI |
InChI=1/C10H9NO/c1-7-2-3-9-8(6-12)5-11-10(9)4-7/h2-6,11H,1H3 |
कैस रजिस्टी संख्या |
4771-49-7 |
आणविक संरचना |
|
घनत्व |
1.226g/cm3 |
उबलने का समय |
339.3°C at 760 mmHg |
अपवर्तक सूचकांक |
1.698 |
फ्लैश प्वाइंट |
167°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|