ChemNet > CAS > 5239-82-7 Cyclopropylacetic acid
5239-82-7 Cyclopropylacetic acid
उत्पाद का नाम |
Cyclopropylacetic acid |
समानार्थी |
Cyclopropaneacetic acid; N,N'-lambda~4~-sulfanediylidenebis(1,3-dimethyl-1,3,2-diazaborolidin-2-amine); 2-cyclopropylacetic acid |
आणविक फार्मूला |
C8H20B2N6S |
आण्विक वजन |
253.9716 |
InChI |
InChI=1/C8H20B2N6S/c1-13-5-6-14(2)9(13)11-17-12-10-15(3)7-8-16(10)4/h5-8H2,1-4H3 |
कैस रजिस्टी संख्या |
5239-82-7 |
आणविक संरचना |
|
घनत्व |
1.16g/cm3 |
उबलने का समय |
293°C at 760 mmHg |
अपवर्तक सूचकांक |
1.584 |
फ्लैश प्वाइंट |
131°C |
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|