ChemNet > CAS > 59084-16-1 1-Acetylpiperidine-4-carbonyl chloride
59084-16-1 1-Acetylpiperidine-4-carbonyl chloride
उत्पाद का नाम |
1-Acetylpiperidine-4-carbonyl chloride |
समानार्थी |
N-Acetylisonipecotoyl chloride; 1-Acetylisonipecotoyl Chloride |
आणविक फार्मूला |
C8H12ClNO2 |
आण्विक वजन |
189.6394 |
InChI |
InChI=1/C8H12ClNO2/c1-6(11)10-4-2-7(3-5-10)8(9)12/h7H,2-5H2,1H3 |
कैस रजिस्टी संख्या |
59084-16-1 |
EINECS |
261-594-7 |
आणविक संरचना |
|
घनत्व |
1.224g/cm3 |
उबलने का समय |
308°C at 760 mmHg |
अपवर्तक सूचकांक |
1.496 |
फ्लैश प्वाइंट |
140.1°C |
खतरा प्रतीक |
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|