ChemNet > CAS > 59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
59944-65-9 4-methyl-1,2,3-thiadiazole-5-carbonyl chloride
उत्पाद का नाम |
4-methyl-1,2,3-thiadiazole-5-carbonyl chloride |
आणविक फार्मूला |
C4H3ClN2OS |
आण्विक वजन |
162.5974 |
InChI |
InChI=1/C4H3ClN2OS/c1-2-3(4(5)8)9-7-6-2/h1H3 |
कैस रजिस्टी संख्या |
59944-65-9 |
आणविक संरचना |
|
घनत्व |
1.504g/cm3 |
उबलने का समय |
239.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.578 |
फ्लैश प्वाइंट |
98.9°C |
खतरा प्रतीक |
C:Corrosive;
|
खतरे के कोड |
R34:Causes burns.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|